C20H20N6O3 — CID 51037526
5-(1,3-benzodioxol-5-ylmethyl)-8-N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-c]quinazoline-2,8-diamine (PubChem CID 51037526) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-8-N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-c]quinazoline-2,8-diamine.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-8-N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-c]quinazoline-2,8-diamine |
|---|---|
| PubChem CID | 51037526 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-8-N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-c]quinazoline-2,8-diamine |
| SMILES | COCCNc1ccc2c(c1)nc(Cc1ccc3c(c1)OCO3)n1nc(N)nc21 |
| InChI | InChI=1S/C20H20N6O3/c1-27-7-6-22-13-3-4-14-15(10-13)23-18(26-19(14)24-20(21)25-26)9-12-2-5-16-17(8-12)29-11-28-16/h2-5,8,10,22H,6-7,9,11H2,1H3,(H2,21,25) |
| InChIKey | GVGRBQBDCRQHQS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|