About (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine
(1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine (PubChem CID 51037648) has the molecular formula C20H17FN4S
and a molecular weight of 364.45 g/mol. Its IUPAC name is (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine.
Molecular Properties
| Compound Name | (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine |
| PubChem CID | 51037648 |
| Molecular Formula | C20H17FN4S |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine |
| SMILES | N[C@@H](CNc1cc(-c2cc3cc(F)ccc3s2)ncn1)c1ccccc1 |
| InChI | InChI=1S/C20H17FN4S/c21-15-6-7-18-14(8-15)9-19(26-18)17-10-20(25-12-24-17)23-11-16(22)13-4-2-1-3-5-13/h1-10,12,16H,11,22H2,(H,23,24,25)/t16-/m0/s1 |
| InChIKey | NZJOEJFTZLDDDE-INIZCTEOSA-N |
| XLogP | 4.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine?
The IUPAC name of (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine (CID 51037648) is (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine.
What is the SMILES notation for (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine?
The canonical SMILES for (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine is N[C@@H](CNc1cc(-c2cc3cc(F)ccc3s2)ncn1)c1ccccc1.
What is the InChIKey of (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine?
The InChIKey is NZJOEJFTZLDDDE-INIZCTEOSA-N. The full InChI is InChI=1S/C20H17FN4S/c21-15-6-7-18-14(8-15)9-19(26-18)17-10-20(25-12-24-17)23-11-16(22)13-4-2-1-3-5-13/h1-10,12,16H,11,22H2,(H,23,24,25)/t16-/m0/s1.
What are the key properties of (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine?
(1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine has a molecular weight of 364.45 g/mol, XLogP of 4.61, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N'-[6-(5-fluoro-1-benzothiophen-2-yl)pyrimidin-4-yl]-1-phenylethane-1,2-diamine is sourced from PubChem (CID 51037648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).