C19H19N7O2 — CID 51037732
8-N-(2-aminoethyl)-5-(1,3-benzodioxol-5-ylmethyl)-[1,2,4]triazolo[1,5-c]quinazoline-2,8-diamine (PubChem CID 51037732) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 8-N-(2-aminoethyl)-5-(1,3-benzodioxol-5-ylmethyl)-[1,2,4]triazolo[1,5-c]quinazoline-2,8-diamine.
| Compound Name | 8-N-(2-aminoethyl)-5-(1,3-benzodioxol-5-ylmethyl)-[1,2,4]triazolo[1,5-c]quinazoline-2,8-diamine |
|---|---|
| PubChem CID | 51037732 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 8-N-(2-aminoethyl)-5-(1,3-benzodioxol-5-ylmethyl)-[1,2,4]triazolo[1,5-c]quinazoline-2,8-diamine |
| SMILES | NCCNc1ccc2c(c1)nc(Cc1ccc3c(c1)OCO3)n1nc(N)nc21 |
| InChI | InChI=1S/C19H19N7O2/c20-5-6-22-12-2-3-13-14(9-12)23-17(26-18(13)24-19(21)25-26)8-11-1-4-15-16(7-11)28-10-27-15/h1-4,7,9,22H,5-6,8,10,20H2,(H2,21,25) |
| InChIKey | VNXRDGWFEVVBHT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |