C35H44N8O5 — CID 51038016
4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-hexylbenzamide (PubChem CID 51038016) has the molecular formula C35H44N8O5 and a molecular weight of 656.79 g/mol. Its IUPAC name is 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-hexylbenzamide.
| Compound Name | 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-hexylbenzamide |
|---|---|
| PubChem CID | 51038016 |
| Molecular Formula | C35H44N8O5 |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-hexylbenzamide |
| SMILES | CCCCCCNC(=O)c1ccc(Nc2nc(NCCOCCOCCNC(=O)c3ccccc3)nc(Nc3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C35H44N8O5/c1-2-3-4-8-19-36-32(46)27-11-13-28(14-12-27)39-34-41-33(42-35(43-34)40-29-15-17-30(44)18-16-29)38-21-23-48-25-24-47-22-20-37-31(45)26-9-6-5-7-10-26/h5-7,9-18,44H,2-4,8,19-25H2,1H3,(H,36,46)(H,37,45)(H3,38,39,40,41,42,43) |
| InChIKey | ZGDSIUHHHWBBPW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|