C21H16F5N5O — CID 51038073
(1R)-N'-[6-[3-(1,1,2,2,2-pentafluoroethyl)-1,2-benzoxazol-6-yl]pyrimidin-4-yl]-1-phenylethane-1,2-diamine (PubChem CID 51038073) has the molecular formula C21H16F5N5O and a molecular weight of 449.38 g/mol. Its IUPAC name is (1R)-N'-[6-[3-(1,1,2,2,2-pentafluoroethyl)-1,2-benzoxazol-6-yl]pyrimidin-4-yl]-1-phenylethane-1,2-diamine.
| Compound Name | (1R)-N'-[6-[3-(1,1,2,2,2-pentafluoroethyl)-1,2-benzoxazol-6-yl]pyrimidin-4-yl]-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 51038073 |
| Molecular Formula | C21H16F5N5O |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (1R)-N'-[6-[3-(1,1,2,2,2-pentafluoroethyl)-1,2-benzoxazol-6-yl]pyrimidin-4-yl]-1-phenylethane-1,2-diamine |
| SMILES | N[C@@H](CNc1cc(-c2ccc3c(C(F)(F)C(F)(F)F)noc3c2)ncn1)c1ccccc1 |
| InChI | InChI=1S/C21H16F5N5O/c22-20(23,21(24,25)26)19-14-7-6-13(8-17(14)32-31-19)16-9-18(30-11-29-16)28-10-15(27)12-4-2-1-3-5-12/h1-9,11,15H,10,27H2,(H,28,29,30)/t15-/m0/s1 |
| InChIKey | YXRWXSCSMQTILJ-HNNXBMFYSA-N |
| XLogP | 5.05 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|