C25H28N4O — CID 51038119
N-[4-(16-cyclobutyl-3,10,16-triazatetracyclo[11.2.1.03,11.04,9]hexadeca-4(9),5,7,10-tetraen-7-yl)phenyl]acetamide (PubChem CID 51038119) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[4-(16-cyclobutyl-3,10,16-triazatetracyclo[11.2.1.03,11.04,9]hexadeca-4(9),5,7,10-tetraen-7-yl)phenyl]acetamide.
| Compound Name | N-[4-(16-cyclobutyl-3,10,16-triazatetracyclo[11.2.1.03,11.04,9]hexadeca-4(9),5,7,10-tetraen-7-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 51038119 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[4-(16-cyclobutyl-3,10,16-triazatetracyclo[11.2.1.03,11.04,9]hexadeca-4(9),5,7,10-tetraen-7-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc3c(c2)nc2n3CC3CCC(C2)N3C2CCC2)cc1 |
| InChI | InChI=1S/C25H28N4O/c1-16(30)26-19-8-5-17(6-9-19)18-7-12-24-23(13-18)27-25-14-21-10-11-22(15-28(24)25)29(21)20-3-2-4-20/h5-9,12-13,20-22H,2-4,10-11,14-15H2,1H3,(H,26,30) |
| InChIKey | IVILUBKNYLJOSL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |