C37H46N8O7 — CID 51038466
methyl 7-[[4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzoyl]amino]heptanoate (PubChem CID 51038466) has the molecular formula C37H46N8O7 and a molecular weight of 714.82 g/mol. Its IUPAC name is methyl 7-[[4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzoyl]amino]heptanoate.
| Compound Name | methyl 7-[[4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzoyl]amino]heptanoate |
|---|---|
| PubChem CID | 51038466 |
| Molecular Formula | C37H46N8O7 |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | methyl 7-[[4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzoyl]amino]heptanoate |
| SMILES | COC(=O)CCCCCCNC(=O)c1ccc(Nc2nc(NCCOCCOCCNC(=O)c3ccccc3)nc(Nc3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C37H46N8O7/c1-50-32(47)11-7-2-3-8-20-38-34(49)28-12-14-29(15-13-28)41-36-43-35(44-37(45-36)42-30-16-18-31(46)19-17-30)40-22-24-52-26-25-51-23-21-39-33(48)27-9-5-4-6-10-27/h4-6,9-10,12-19,46H,2-3,7-8,11,20-26H2,1H3,(H,38,49)(H,39,48)(H3,40,41,42,43,44,45) |
| InChIKey | QUGOGIMKYSACGJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 197.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|