C29H28FN3O4 — CID 51038976
methyl 2-[5-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetate (PubChem CID 51038976) has the molecular formula C29H28FN3O4 and a molecular weight of 501.56 g/mol. Its IUPAC name is methyl 2-[5-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetate.
| Compound Name | methyl 2-[5-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 51038976 |
| Molecular Formula | C29H28FN3O4 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | methyl 2-[5-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetate |
| SMILES | COC(=O)Cc1cn(Cc2ccc(F)cc2)c2ccc(OCCCN(C)c3nc4ccccc4o3)cc12 |
| InChI | InChI=1S/C29H28FN3O4/c1-32(29-31-25-6-3-4-7-27(25)37-29)14-5-15-36-23-12-13-26-24(17-23)21(16-28(34)35-2)19-33(26)18-20-8-10-22(30)11-9-20/h3-4,6-13,17,19H,5,14-16,18H2,1-2H3 |
| InChIKey | CFPZGRNSMYCWOQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 69.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|