About N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine
N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine (PubChem CID 51039122) has the molecular formula C21H23F3N2O
and a molecular weight of 376.42 g/mol. Its IUPAC name is N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine.
Molecular Properties
| Compound Name | N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine |
| PubChem CID | 51039122 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine |
| SMILES | Cc1cc(Oc2cccc(C(F)(F)F)c2)c(C)cc1/N=C/N1CCCCC1 |
| InChI | InChI=1S/C21H23F3N2O/c1-15-12-20(27-18-8-6-7-17(13-18)21(22,23)24)16(2)11-19(15)25-14-26-9-4-3-5-10-26/h6-8,11-14H,3-5,9-10H2,1-2H3/b25-14+ |
| InChIKey | OKAQVBDZSOIEDK-AFUMVMLFSA-N |
| XLogP | 6.26 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine?
The IUPAC name of N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine (CID 51039122) is N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine.
What is the SMILES notation for N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine?
The canonical SMILES for N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine is Cc1cc(Oc2cccc(C(F)(F)F)c2)c(C)cc1/N=C/N1CCCCC1.
What is the InChIKey of N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine?
The InChIKey is OKAQVBDZSOIEDK-AFUMVMLFSA-N. The full InChI is InChI=1S/C21H23F3N2O/c1-15-12-20(27-18-8-6-7-17(13-18)21(22,23)24)16(2)11-19(15)25-14-26-9-4-3-5-10-26/h6-8,11-14H,3-5,9-10H2,1-2H3/b25-14+.
What are the key properties of N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine?
N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine has a molecular weight of 376.42 g/mol, XLogP of 6.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-dimethyl-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-piperidin-1-ylmethanimine is sourced from PubChem (CID 51039122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).