C24H29NO — CID 51039322
(E)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-3-phenylprop-2-enamide (PubChem CID 51039322) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is (E)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 51039322 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (E)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-3-phenylprop-2-enamide |
| SMILES | Cc1cc2c(cc1NC(=O)/C=C/c1ccccc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H29NO/c1-17-15-19-20(24(4,5)14-13-23(19,2)3)16-21(17)25-22(26)12-11-18-9-7-6-8-10-18/h6-12,15-16H,13-14H2,1-5H3,(H,25,26)/b12-11+ |
| InChIKey | QDJBRKMRGKFUMB-VAWYXSNFSA-N |
| XLogP | 6.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|