C18H16F6N6O — CID 51039463
N-[2-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide (PubChem CID 51039463) has the molecular formula C18H16F6N6O and a molecular weight of 446.36 g/mol. Its IUPAC name is N-[2-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide.
| Compound Name | N-[2-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide |
|---|---|
| PubChem CID | 51039463 |
| Molecular Formula | C18H16F6N6O |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[2-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide |
| SMILES | Cc1nc2c(NC(=O)Cn3nc(C(F)(F)F)c4c3CCCC4)cc(C(F)(F)F)cn2n1 |
| InChI | InChI=1S/C18H16F6N6O/c1-9-25-16-12(6-10(17(19,20)21)7-30(16)27-9)26-14(31)8-29-13-5-3-2-4-11(13)15(28-29)18(22,23)24/h6-7H,2-5,8H2,1H3,(H,26,31) |
| InChIKey | FGFBXXNKVJYQLD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |