C23H27BrO3Si — CID 51039496
(2R,3R,4R,5S)-2-[(E)-2-(2-bromophenyl)ethenyl]-4-[dimethyl(phenyl)silyl]-5-(methoxymethyl)oxolane-3-carbaldehyde (PubChem CID 51039496) has the molecular formula C23H27BrO3Si and a molecular weight of 459.46 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[(E)-2-(2-bromophenyl)ethenyl]-4-[dimethyl(phenyl)silyl]-5-(methoxymethyl)oxolane-3-carbaldehyde.
| Compound Name | (2R,3R,4R,5S)-2-[(E)-2-(2-bromophenyl)ethenyl]-4-[dimethyl(phenyl)silyl]-5-(methoxymethyl)oxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 51039496 |
| Molecular Formula | C23H27BrO3Si |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (2R,3R,4R,5S)-2-[(E)-2-(2-bromophenyl)ethenyl]-4-[dimethyl(phenyl)silyl]-5-(methoxymethyl)oxolane-3-carbaldehyde |
| SMILES | COC[C@@H]1O[C@H](/C=C/c2ccccc2Br)[C@H](C=O)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H27BrO3Si/c1-26-16-22-23(28(2,3)18-10-5-4-6-11-18)19(15-25)21(27-22)14-13-17-9-7-8-12-20(17)24/h4-15,19,21-23H,16H2,1-3H3/b14-13+/t19-,21+,22-,23+/m0/s1 |
| InChIKey | ZUYWLTVWGPZDGS-CMEFCSHJSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|