C19H12N2O6 — CID 51039517
1-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]pyrimidine-2,4-dione (PubChem CID 51039517) has the molecular formula C19H12N2O6 and a molecular weight of 364.31 g/mol. Its IUPAC name is 1-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51039517 |
| Molecular Formula | C19H12N2O6 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]pyrimidine-2,4-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cc(Cn3ccc(=O)[nH]c3=O)cc21 |
| InChI | InChI=1S/C19H12N2O6/c22-12-3-1-2-10-15(12)18(26)16-11(17(10)25)6-9(7-13(16)23)8-21-5-4-14(24)20-19(21)27/h1-7,22-23H,8H2,(H,20,24,27) |
| InChIKey | ZARCFDYOBUXKDA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|