C10H14N2O — CID 51039714
2,4-dimethyl-5,6,7,8-tetrahydro-1,8-naphthyridin-3-ol (PubChem CID 51039714) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 2,4-dimethyl-5,6,7,8-tetrahydro-1,8-naphthyridin-3-ol.
| Compound Name | 2,4-dimethyl-5,6,7,8-tetrahydro-1,8-naphthyridin-3-ol |
|---|---|
| PubChem CID | 51039714 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2,4-dimethyl-5,6,7,8-tetrahydro-1,8-naphthyridin-3-ol |
| SMILES | Cc1nc2c(c(C)c1O)CCCN2 |
| InChI | InChI=1S/C10H14N2O/c1-6-8-4-3-5-11-10(8)12-7(2)9(6)13/h13H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | SDBANJKOQFGUMB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |