C23H30FeN6+2 — CID 51039853
iron(2+);N-(quinolin-4-ylmethyl)-2-(3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl)ethanamine (PubChem CID 51039853) has the molecular formula C23H30FeN6+2 and a molecular weight of 446.38 g/mol. Its IUPAC name is iron(2+);N-(quinolin-4-ylmethyl)-2-(3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl)ethanamine.
| Compound Name | iron(2+);N-(quinolin-4-ylmethyl)-2-(3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl)ethanamine |
|---|---|
| PubChem CID | 51039853 |
| Molecular Formula | C23H30FeN6+2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | iron(2+);N-(quinolin-4-ylmethyl)-2-(3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl)ethanamine |
| SMILES | [Fe+2].c1cc2nc(c1)CNCCN(CCNCc1ccnc3ccccc13)CCNC2 |
| InChI | InChI=1S/C23H30N6.Fe/c1-2-7-23-22(6-1)19(8-9-27-23)16-24-10-13-29-14-11-25-17-20-4-3-5-21(28-20)18-26-12-15-29;/h1-9,24-26H,10-18H2;/q;+2 |
| InChIKey | LTOVTCIPMXLXHT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|