C15H22N6O4 — CID 51039859
5-[[5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]pentylamino]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 51039859) has the molecular formula C15H22N6O4 and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-[[5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]pentylamino]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[[5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]pentylamino]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51039859 |
| Molecular Formula | C15H22N6O4 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5-[[5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]pentylamino]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(CNCCCCCNCc2c[nH]c(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H22N6O4/c22-12-10(8-18-14(24)20-12)6-16-4-2-1-3-5-17-7-11-9-19-15(25)21-13(11)23/h8-9,16-17H,1-7H2,(H2,18,20,22,24)(H2,19,21,23,25) |
| InChIKey | CAVHRCDIIFHUPW-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 155.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|