C25H22F3N5O6 — CID 51039915
ethyl 7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate (PubChem CID 51039915) has the molecular formula C25H22F3N5O6 and a molecular weight of 545.47 g/mol. Its IUPAC name is ethyl 7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate.
| Compound Name | ethyl 7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate |
|---|---|
| PubChem CID | 51039915 |
| Molecular Formula | C25H22F3N5O6 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | ethyl 7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(Cn3cc(C(CC)(OC(=O)c4ccc([N+](=O)[O-])cc4)C(F)(F)F)nn3)ccn2c1 |
| InChI | InChI=1S/C25H22F3N5O6/c1-3-24(25(26,27)28,39-23(35)17-5-7-19(8-6-17)33(36)37)21-15-32(30-29-21)13-16-9-10-31-14-18(12-20(31)11-16)22(34)38-4-2/h5-12,14-15H,3-4,13H2,1-2H3 |
| InChIKey | HYXRQDHLROWJAX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 130.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|