C25H23Cl6NO8S — CID 51039937
[(2R,4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 51039937) has the molecular formula C25H23Cl6NO8S and a molecular weight of 710.24 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 51039937 |
| Molecular Formula | C25H23Cl6NO8S |
| Molecular Weight | 710.24 g/mol |
| Exact Mass | 706.93 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | O=C(N[C@@H]1[C@@H](OC(=O)OCC(Cl)(Cl)Cl)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O[C@H]1Sc1ccccc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H23Cl6NO8S/c26-24(27,28)12-36-22(33)32-17-19(40-23(34)37-13-25(29,30)31)18-16(38-21(17)41-15-9-5-2-6-10-15)11-35-20(39-18)14-7-3-1-4-8-14/h1-10,16-21H,11-13H2,(H,32,33)/t16-,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | URYMNBUEJNWMOH-UFOPBENGSA-N |
| XLogP | 6.97 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.24 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|