C20H32O4 — CID 51039968
(1R,2R,6R,7R,8R,9R,10S,12S)-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-3-ene-9,10,12-triol (PubChem CID 51039968) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1R,2R,6R,7R,8R,9R,10S,12S)-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-3-ene-9,10,12-triol.
| Compound Name | (1R,2R,6R,7R,8R,9R,10S,12S)-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-3-ene-9,10,12-triol |
|---|---|
| PubChem CID | 51039968 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1R,2R,6R,7R,8R,9R,10S,12S)-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-3-ene-9,10,12-triol |
| SMILES | C=C1C[C@H]2O[C@H]([C@H]3[C@@H]2C(C)=CC[C@@H]3C(C)C)[C@](C)(O)[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C20H32O4/c1-10(2)13-7-6-11(3)17-15-8-12(4)14(21)9-16(22)20(5,23)19(24-15)18(13)17/h6,10,13-19,21-23H,4,7-9H2,1-3,5H3/t13-,14+,15-,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | PMIONIXTNXHIOX-RNAQZQGESA-N |
| XLogP | 2.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|