C19H24Cl2N2 — CID 51040019
4,9-dichloro-N-hexyl-5,6,7,8-tetrahydroacridin-2-amine (PubChem CID 51040019) has the molecular formula C19H24Cl2N2 and a molecular weight of 351.32 g/mol. Its IUPAC name is 4,9-dichloro-N-hexyl-5,6,7,8-tetrahydroacridin-2-amine.
| Compound Name | 4,9-dichloro-N-hexyl-5,6,7,8-tetrahydroacridin-2-amine |
|---|---|
| PubChem CID | 51040019 |
| Molecular Formula | C19H24Cl2N2 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4,9-dichloro-N-hexyl-5,6,7,8-tetrahydroacridin-2-amine |
| SMILES | CCCCCCNc1cc(Cl)c2nc3c(c(Cl)c2c1)CCCC3 |
| InChI | InChI=1S/C19H24Cl2N2/c1-2-3-4-7-10-22-13-11-15-18(21)14-8-5-6-9-17(14)23-19(15)16(20)12-13/h11-12,22H,2-10H2,1H3 |
| InChIKey | JPABNBLCNSYNOL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|