C19H25F2N5O — CID 51040090
(2R)-1-[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)piperidin-3-yl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]propan-2-ol (PubChem CID 51040090) has the molecular formula C19H25F2N5O and a molecular weight of 377.44 g/mol. Its IUPAC name is (2R)-1-[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)piperidin-3-yl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]propan-2-ol.
| Compound Name | (2R)-1-[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)piperidin-3-yl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 51040090 |
| Molecular Formula | C19H25F2N5O |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2R)-1-[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)piperidin-3-yl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]propan-2-ol |
| SMILES | C[C@@H](O)Cn1cc2c(n1)CN([C@H]1CN[C@H](c3cc(F)ccc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C19H25F2N5O/c1-11(27)7-26-9-12-8-25(10-18(12)24-26)14-5-17(22)19(23-6-14)15-4-13(20)2-3-16(15)21/h2-4,9,11,14,17,19,23,27H,5-8,10,22H2,1H3/t11-,14-,17+,19-/m1/s1 |
| InChIKey | HQYAMWDRXNIEFD-HRKYJCBASA-N |
| XLogP | 1.29 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |