C29H24F3N7O6 — CID 51040119
[2-[1-[[2-carbamoyl-3-(6-methoxy-3-pyridinyl)indolizin-7-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate (PubChem CID 51040119) has the molecular formula C29H24F3N7O6 and a molecular weight of 623.55 g/mol. Its IUPAC name is [2-[1-[[2-carbamoyl-3-(6-methoxy-3-pyridinyl)indolizin-7-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate.
| Compound Name | [2-[1-[[2-carbamoyl-3-(6-methoxy-3-pyridinyl)indolizin-7-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 51040119 |
| Molecular Formula | C29H24F3N7O6 |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | [2-[1-[[2-carbamoyl-3-(6-methoxy-3-pyridinyl)indolizin-7-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
| SMILES | CCC(OC(=O)c1ccc([N+](=O)[O-])cc1)(c1cn(Cc2ccn3c(-c4ccc(OC)nc4)c(C(N)=O)cc3c2)nn1)C(F)(F)F |
| InChI | InChI=1S/C29H24F3N7O6/c1-3-28(29(30,31)32,45-27(41)18-4-7-20(8-5-18)39(42)43)23-16-37(36-35-23)15-17-10-11-38-21(12-17)13-22(26(33)40)25(38)19-6-9-24(44-2)34-14-19/h4-14,16H,3,15H2,1-2H3,(H2,33,40) |
| InChIKey | FPCLOSOPHIVSTI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 169.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|