C31H27F3N6O7 — CID 51040121
ethyl 3-(6-methoxy-3-pyridinyl)-7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate (PubChem CID 51040121) has the molecular formula C31H27F3N6O7 and a molecular weight of 652.59 g/mol. Its IUPAC name is ethyl 3-(6-methoxy-3-pyridinyl)-7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate.
| Compound Name | ethyl 3-(6-methoxy-3-pyridinyl)-7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate |
|---|---|
| PubChem CID | 51040121 |
| Molecular Formula | C31H27F3N6O7 |
| Molecular Weight | 652.59 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | ethyl 3-(6-methoxy-3-pyridinyl)-7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(Cn3cc(C(CC)(OC(=O)c4ccc([N+](=O)[O-])cc4)C(F)(F)F)nn3)ccn2c1-c1ccc(OC)nc1 |
| InChI | InChI=1S/C31H27F3N6O7/c1-4-30(31(32,33)34,47-28(41)20-6-9-22(10-7-20)40(43)44)25-18-38(37-36-25)17-19-12-13-39-23(14-19)15-24(29(42)46-5-2)27(39)21-8-11-26(45-3)35-16-21/h6-16,18H,4-5,17H2,1-3H3 |
| InChIKey | VOMYBOUSQLUTIS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 152.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|