C18H17NO6 — CID 51040149
2-[2-(2-methoxycarbonyl-4-phenylanilino)-2-oxoethoxy]acetic acid (PubChem CID 51040149) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-[2-(2-methoxycarbonyl-4-phenylanilino)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(2-methoxycarbonyl-4-phenylanilino)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 51040149 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[2-(2-methoxycarbonyl-4-phenylanilino)-2-oxoethoxy]acetic acid |
| SMILES | COC(=O)c1cc(-c2ccccc2)ccc1NC(=O)COCC(=O)O |
| InChI | InChI=1S/C18H17NO6/c1-24-18(23)14-9-13(12-5-3-2-4-6-12)7-8-15(14)19-16(20)10-25-11-17(21)22/h2-9H,10-11H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | XTGSDYLQAQTZHU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |