C32H30N2O6 — CID 51040195
ethyl (3'R,4'R)-4'-[(2S,3R)-1-(4-methoxyphenyl)-4-oxo-3-phenylazetidin-2-yl]-1'-methyl-1,3-dioxospiro[indene-2,2'-pyrrolidine]-3'-carboxylate (PubChem CID 51040195) has the molecular formula C32H30N2O6 and a molecular weight of 538.60 g/mol. Its IUPAC name is ethyl (3'R,4'R)-4'-[(2S,3R)-1-(4-methoxyphenyl)-4-oxo-3-phenylazetidin-2-yl]-1'-methyl-1,3-dioxospiro[indene-2,2'-pyrrolidine]-3'-carboxylate.
| Compound Name | ethyl (3'R,4'R)-4'-[(2S,3R)-1-(4-methoxyphenyl)-4-oxo-3-phenylazetidin-2-yl]-1'-methyl-1,3-dioxospiro[indene-2,2'-pyrrolidine]-3'-carboxylate |
|---|---|
| PubChem CID | 51040195 |
| Molecular Formula | C32H30N2O6 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | ethyl (3'R,4'R)-4'-[(2S,3R)-1-(4-methoxyphenyl)-4-oxo-3-phenylazetidin-2-yl]-1'-methyl-1,3-dioxospiro[indene-2,2'-pyrrolidine]-3'-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]([C@H]2[C@@H](c3ccccc3)C(=O)N2c2ccc(OC)cc2)CN(C)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C32H30N2O6/c1-4-40-31(38)26-24(18-33(2)32(26)28(35)22-12-8-9-13-23(22)29(32)36)27-25(19-10-6-5-7-11-19)30(37)34(27)20-14-16-21(39-3)17-15-20/h5-17,24-27H,4,18H2,1-3H3/t24-,25+,26-,27-/m0/s1 |
| InChIKey | YICNHMMHLSYKKP-XUJYPJAKSA-N |
| XLogP | 3.75 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|