C27H22O2 — CID 51040426
(2E,4E,6E,8E)-3,7-dimethyl-9-pyren-1-ylnona-2,4,6,8-tetraenoic acid (PubChem CID 51040426) has the molecular formula C27H22O2 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-9-pyren-1-ylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-9-pyren-1-ylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 51040426 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-9-pyren-1-ylnona-2,4,6,8-tetraenoic acid |
| SMILES | CC(/C=C/c1ccc2ccc3cccc4ccc1c2c34)=C\C=C\C(C)=C\C(=O)O |
| InChI | InChI=1S/C27H22O2/c1-18(5-3-6-19(2)17-25(28)29)9-10-20-11-12-23-14-13-21-7-4-8-22-15-16-24(20)27(23)26(21)22/h3-17H,1-2H3,(H,28,29)/b6-3+,10-9+,18-5+,19-17+ |
| InChIKey | LLPAWPUHWPYZJC-PANGCVPZSA-N |
| XLogP | 7.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|