C21H19NO3S — CID 51040446
(3R,4S)-4-[(1R)-1-hydroxy-2-phenylbuta-2,3-dienyl]-3-methoxy-1-(3-thiophen-2-ylprop-2-ynyl)azetidin-2-one (PubChem CID 51040446) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is (3R,4S)-4-[(1R)-1-hydroxy-2-phenylbuta-2,3-dienyl]-3-methoxy-1-(3-thiophen-2-ylprop-2-ynyl)azetidin-2-one.
| Compound Name | (3R,4S)-4-[(1R)-1-hydroxy-2-phenylbuta-2,3-dienyl]-3-methoxy-1-(3-thiophen-2-ylprop-2-ynyl)azetidin-2-one |
|---|---|
| PubChem CID | 51040446 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (3R,4S)-4-[(1R)-1-hydroxy-2-phenylbuta-2,3-dienyl]-3-methoxy-1-(3-thiophen-2-ylprop-2-ynyl)azetidin-2-one |
| SMILES | C=C=C(c1ccccc1)[C@@H](O)[C@H]1[C@@H](OC)C(=O)N1CC#Cc1cccs1 |
| InChI | InChI=1S/C21H19NO3S/c1-3-17(15-9-5-4-6-10-15)19(23)18-20(25-2)21(24)22(18)13-7-11-16-12-8-14-26-16/h4-6,8-10,12,14,18-20,23H,1,13H2,2H3/t18-,19+,20+/m0/s1 |
| InChIKey | XNJXLRYNWFETRK-XUVXKRRUSA-N |
| XLogP | 2.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|