C13H17FN4O3 — CID 51040491
(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4,5-dimethyloxolan-3-ol (PubChem CID 51040491) has the molecular formula C13H17FN4O3 and a molecular weight of 296.30 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4,5-dimethyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4,5-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 51040491 |
| Molecular Formula | C13H17FN4O3 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4,5-dimethyloxolan-3-ol |
| SMILES | C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](CO)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C13H17FN4O3/c1-12(14)10(20)8(5-19)21-13(12,2)9-4-3-7-11(15)16-6-17-18(7)9/h3-4,6,8,10,19-20H,5H2,1-2H3,(H2,15,16,17)/t8-,10-,12-,13+/m1/s1 |
| InChIKey | UDWTVWSLMPYQOK-DXLKZPDWSA-N |
| XLogP | 0.01 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |