C22H22F2O2 — CID 51040541
(2R,7S)-2,7-bis(4-fluorophenyl)-4,9-dimethylidene-1,6-dioxecane (PubChem CID 51040541) has the molecular formula C22H22F2O2 and a molecular weight of 356.41 g/mol. Its IUPAC name is (2R,7S)-2,7-bis(4-fluorophenyl)-4,9-dimethylidene-1,6-dioxecane.
| Compound Name | (2R,7S)-2,7-bis(4-fluorophenyl)-4,9-dimethylidene-1,6-dioxecane |
|---|---|
| PubChem CID | 51040541 |
| Molecular Formula | C22H22F2O2 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2R,7S)-2,7-bis(4-fluorophenyl)-4,9-dimethylidene-1,6-dioxecane |
| SMILES | C=C1CO[C@@H](c2ccc(F)cc2)CC(=C)CO[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H22F2O2/c1-15-11-21(17-3-7-19(23)8-4-17)26-14-16(2)12-22(25-13-15)18-5-9-20(24)10-6-18/h3-10,21-22H,1-2,11-14H2/t21-,22+ |
| InChIKey | HQTQRUIHWZAEBU-SZPZYZBQSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|