C20H26Cl2N4O4 — CID 51040610
1-N,2-N-bis[(3-nitrophenyl)methyl]cyclohexane-1,2-diamine;dihydrochloride (PubChem CID 51040610) has the molecular formula C20H26Cl2N4O4 and a molecular weight of 457.36 g/mol. Its IUPAC name is 1-N,2-N-bis[(3-nitrophenyl)methyl]cyclohexane-1,2-diamine;dihydrochloride.
| Compound Name | 1-N,2-N-bis[(3-nitrophenyl)methyl]cyclohexane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 51040610 |
| Molecular Formula | C20H26Cl2N4O4 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-N,2-N-bis[(3-nitrophenyl)methyl]cyclohexane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cccc(CNC2CCCCC2NCc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H24N4O4.2ClH/c25-23(26)17-7-3-5-15(11-17)13-21-19-9-1-2-10-20(19)22-14-16-6-4-8-18(12-16)24(27)28;;/h3-8,11-12,19-22H,1-2,9-10,13-14H2;2*1H |
| InChIKey | ZHZTZJBEEOJAGC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|