C32H34ClN9O — CID 51041052
4-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-2-N-(2-methylphenyl)-6-N-(3-morpholin-4-ylpropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 51041052) has the molecular formula C32H34ClN9O and a molecular weight of 596.14 g/mol. Its IUPAC name is 4-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-2-N-(2-methylphenyl)-6-N-(3-morpholin-4-ylpropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-2-N-(2-methylphenyl)-6-N-(3-morpholin-4-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 51041052 |
| Molecular Formula | C32H34ClN9O |
| Molecular Weight | 596.14 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 4-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-2-N-(2-methylphenyl)-6-N-(3-morpholin-4-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccccc1Nc1nc(NCCCN2CCOCC2)nc(Nc2ccc(Nc3ccnc4cc(Cl)ccc34)cc2)n1 |
| InChI | InChI=1S/C32H34ClN9O/c1-22-5-2-3-6-27(22)38-32-40-30(35-14-4-16-42-17-19-43-20-18-42)39-31(41-32)37-25-10-8-24(9-11-25)36-28-13-15-34-29-21-23(33)7-12-26(28)29/h2-3,5-13,15,21H,4,14,16-20H2,1H3,(H,34,36)(H3,35,37,38,39,40,41) |
| InChIKey | JRSHCOWPGZTVIG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.14 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|