C22H24N2O — CID 51041205
1-(11-methyl-11,21-diazatetracyclo[12.7.0.03,8.015,20]henicosa-1(14),3,5,7,15,17,19-heptaen-21-yl)ethanone (PubChem CID 51041205) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-(11-methyl-11,21-diazatetracyclo[12.7.0.03,8.015,20]henicosa-1(14),3,5,7,15,17,19-heptaen-21-yl)ethanone.
| Compound Name | 1-(11-methyl-11,21-diazatetracyclo[12.7.0.03,8.015,20]henicosa-1(14),3,5,7,15,17,19-heptaen-21-yl)ethanone |
|---|---|
| PubChem CID | 51041205 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-(11-methyl-11,21-diazatetracyclo[12.7.0.03,8.015,20]henicosa-1(14),3,5,7,15,17,19-heptaen-21-yl)ethanone |
| SMILES | CC(=O)n1c2c(c3ccccc31)CCN(C)CCc1ccccc1C2 |
| InChI | InChI=1S/C22H24N2O/c1-16(25)24-21-10-6-5-9-19(21)20-12-14-23(2)13-11-17-7-3-4-8-18(17)15-22(20)24/h3-10H,11-15H2,1-2H3 |
| InChIKey | LNSBWPAEZYWMDD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |