About N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate
N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate (PubChem CID 51041254) has the molecular formula C20H18F3N3O3S
and a molecular weight of 437.44 g/mol. Its IUPAC name is N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate |
| PubChem CID | 51041254 |
| Molecular Formula | C20H18F3N3O3S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate |
| SMILES | C[n+]1cc2[nH]c3ccccc3c2cc1NCc1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H17N3.CHF3O3S/c1-22-13-18-16(15-9-5-6-10-17(15)21-18)11-19(22)20-12-14-7-3-2-4-8-14;2-1(3,4)8(5,6)7/h2-11,13H,12H2,1H3,(H,20,21);(H,5,6,7) |
| InChIKey | IYFUOKKYBOBEOV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate?
The IUPAC name of N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate (CID 51041254) is N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate.
What is the SMILES notation for N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate?
The canonical SMILES for N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate is C[n+]1cc2[nH]c3ccccc3c2cc1NCc1ccccc1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate?
The InChIKey is IYFUOKKYBOBEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3.CHF3O3S/c1-22-13-18-16(15-9-5-6-10-17(15)21-18)11-19(22)20-12-14-7-3-2-4-8-14;2-1(3,4)8(5,6)7/h2-11,13H,12H2,1H3,(H,20,21);(H,5,6,7).
What are the key properties of N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate?
N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate has a molecular weight of 437.44 g/mol, XLogP of 3.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine;trifluoromethanesulfonate is sourced from PubChem (CID 51041254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).