C29H29ClN8 — CID 51041259
6-N-butyl-2-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 51041259) has the molecular formula C29H29ClN8 and a molecular weight of 525.06 g/mol. Its IUPAC name is 6-N-butyl-2-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-butyl-2-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 51041259 |
| Molecular Formula | C29H29ClN8 |
| Molecular Weight | 525.06 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 6-N-butyl-2-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCNc1nc(Nc2ccc(C)cc2)nc(Nc2ccc(Nc3ccnc4cc(Cl)ccc34)cc2)n1 |
| InChI | InChI=1S/C29H29ClN8/c1-3-4-16-32-27-36-28(34-22-8-5-19(2)6-9-22)38-29(37-27)35-23-12-10-21(11-13-23)33-25-15-17-31-26-18-20(30)7-14-24(25)26/h5-15,17-18H,3-4,16H2,1-2H3,(H,31,33)(H3,32,34,35,36,37,38) |
| InChIKey | VZTRJYJLZJMDBO-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.06 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|