C31H38N2O8Si — CID 51041279
[(2R,3S,4R,5R)-4-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-2,5-dimethyloxolan-3-yl] benzoate (PubChem CID 51041279) has the molecular formula C31H38N2O8Si and a molecular weight of 594.74 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-2,5-dimethyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-4-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-2,5-dimethyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 51041279 |
| Molecular Formula | C31H38N2O8Si |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | [(2R,3S,4R,5R)-4-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-2,5-dimethyloxolan-3-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(C)O[C@@](C)(n2ccc(=O)[nH]c2=O)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H38N2O8Si/c1-29(2,3)42(6,7)38-20-30(4)24(39-26(35)21-14-10-8-11-15-21)25(40-27(36)22-16-12-9-13-17-22)31(5,41-30)33-19-18-23(34)32-28(33)37/h8-19,24-25H,20H2,1-7H3,(H,32,34,37)/t24-,25+,30+,31+/m0/s1 |
| InChIKey | UEGMKMACEXHIAE-KWGZYXKDSA-N |
| XLogP | 4.47 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|