C24H22N4O5 — CID 5104165
5-(4-benzyl-3,5-dioxo-1,2,4-triazolidin-1-yl)-2-(3-methoxyphenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 5104165) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is 5-(4-benzyl-3,5-dioxo-1,2,4-triazolidin-1-yl)-2-(3-methoxyphenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 5-(4-benzyl-3,5-dioxo-1,2,4-triazolidin-1-yl)-2-(3-methoxyphenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 5104165 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 5-(4-benzyl-3,5-dioxo-1,2,4-triazolidin-1-yl)-2-(3-methoxyphenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1cccc(N2C(=O)C3C=CC(n4[nH]c(=O)n(Cc5ccccc5)c4=O)CC3C2=O)c1 |
| InChI | InChI=1S/C24H22N4O5/c1-33-18-9-5-8-16(12-18)27-21(29)19-11-10-17(13-20(19)22(27)30)28-24(32)26(23(31)25-28)14-15-6-3-2-4-7-15/h2-12,17,19-20H,13-14H2,1H3,(H,25,31) |
| InChIKey | XQNXNMMTUFNFLS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|