C19H22F6O2 — CID 51041733
(1R,2R,4S)-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 51041733) has the molecular formula C19H22F6O2 and a molecular weight of 396.37 g/mol. Its IUPAC name is (1R,2R,4S)-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4S)-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 51041733 |
| Molecular Formula | C19H22F6O2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (1R,2R,4S)-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@](C)(C2)[C@]1(O)c1ccccc1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H22F6O2/c1-14(2)11-8-9-15(3,10-11)16(14,26)12-6-4-5-7-13(12)17(27,18(20,21)22)19(23,24)25/h4-7,11,26-27H,8-10H2,1-3H3/t11-,15+,16-/m0/s1 |
| InChIKey | LIPLJHDAYVWABZ-XZJROXQQSA-N |
| XLogP | 5.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |