C15H16N4O2S — CID 51041933
ethyl 2-[(6-cyano-7,8,9,10-tetrahydro-[1,2,4]triazolo[3,4-a]isoquinolin-5-yl)sulfanyl]acetate (PubChem CID 51041933) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is ethyl 2-[(6-cyano-7,8,9,10-tetrahydro-[1,2,4]triazolo[3,4-a]isoquinolin-5-yl)sulfanyl]acetate.
| Compound Name | ethyl 2-[(6-cyano-7,8,9,10-tetrahydro-[1,2,4]triazolo[3,4-a]isoquinolin-5-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 51041933 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | ethyl 2-[(6-cyano-7,8,9,10-tetrahydro-[1,2,4]triazolo[3,4-a]isoquinolin-5-yl)sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1c(C#N)c2c(c3nncn13)CCCC2 |
| InChI | InChI=1S/C15H16N4O2S/c1-2-21-13(20)8-22-15-12(7-16)10-5-3-4-6-11(10)14-18-17-9-19(14)15/h9H,2-6,8H2,1H3 |
| InChIKey | PANUCSFNYBJTGQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |