About 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one
5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one (PubChem CID 51042075) has the molecular formula C14H15NOS
and a molecular weight of 245.35 g/mol. Its IUPAC name is 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one.
Molecular Properties
| Compound Name | 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one |
| PubChem CID | 51042075 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one |
| SMILES | O=C(CCCCc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C14H15NOS/c16-13(14-15-10-11-17-14)9-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,10-11H,4-5,8-9H2 |
| InChIKey | AOYPVCZZUFRAFK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one?
The IUPAC name of 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one (CID 51042075) is 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one.
What is the SMILES notation for 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one?
The canonical SMILES for 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one is O=C(CCCCc1ccccc1)c1nccs1.
What is the InChIKey of 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one?
The InChIKey is AOYPVCZZUFRAFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NOS/c16-13(14-15-10-11-17-14)9-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,10-11H,4-5,8-9H2.
What are the key properties of 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one?
5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one has a molecular weight of 245.35 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1-(1,3-thiazol-2-yl)pentan-1-one is sourced from PubChem (CID 51042075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).