C22H25N2O6P — CID 51042192
ethyl 3-diethoxyphosphoryl-2'-oxo-1'-phenylspiro[aziridine-2,3'-indole]-1-carboxylate (PubChem CID 51042192) has the molecular formula C22H25N2O6P and a molecular weight of 444.42 g/mol. Its IUPAC name is ethyl 3-diethoxyphosphoryl-2'-oxo-1'-phenylspiro[aziridine-2,3'-indole]-1-carboxylate.
| Compound Name | ethyl 3-diethoxyphosphoryl-2'-oxo-1'-phenylspiro[aziridine-2,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 51042192 |
| Molecular Formula | C22H25N2O6P |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 3-diethoxyphosphoryl-2'-oxo-1'-phenylspiro[aziridine-2,3'-indole]-1-carboxylate |
| SMILES | CCOC(=O)N1C(P(=O)(OCC)OCC)C12C(=O)N(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C22H25N2O6P/c1-4-28-21(26)24-20(31(27,29-5-2)30-6-3)22(24)17-14-10-11-15-18(17)23(19(22)25)16-12-8-7-9-13-16/h7-15,20H,4-6H2,1-3H3 |
| InChIKey | MSOOOEOTMCPRQW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|