C17H20ClN7O2S2 — CID 51042591
[[5-[(carbamothioylamino)carbamoyl]-4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carbonyl]amino]thiourea (PubChem CID 51042591) has the molecular formula C17H20ClN7O2S2 and a molecular weight of 453.98 g/mol. Its IUPAC name is [[5-[(carbamothioylamino)carbamoyl]-4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carbonyl]amino]thiourea.
| Compound Name | [[5-[(carbamothioylamino)carbamoyl]-4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 51042591 |
| Molecular Formula | C17H20ClN7O2S2 |
| Molecular Weight | 453.98 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | [[5-[(carbamothioylamino)carbamoyl]-4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carbonyl]amino]thiourea |
| SMILES | CC1=C(C(=O)NNC(N)=S)C(c2ccc(Cl)cc2)C(C(=O)NNC(N)=S)=C(C)N1 |
| InChI | InChI=1S/C17H20ClN7O2S2/c1-7-11(14(26)22-24-16(19)28)13(9-3-5-10(18)6-4-9)12(8(2)21-7)15(27)23-25-17(20)29/h3-6,13,21H,1-2H3,(H,22,26)(H,23,27)(H3,19,24,28)(H3,20,25,29) |
| InChIKey | YZCWIIGIIVZTJG-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.98 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|