C31H50O3 — CID 51042623
poricotriol A (PubChem CID 51042623) has the molecular formula C31H50O3 and a molecular weight of 470.70 g/mol. Its IUPAC name is (2R,3R,3aR,6S,7S,9bR)-3-[(2R)-1-hydroxy-6-methyl-5-methylideneheptan-2-yl]-6-(3-hydroxypropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-2-ol.
| Compound Name | poricotriol A |
|---|---|
| PubChem CID | 51042623 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | (2R,3R,3aR,6S,7S,9bR)-3-[(2R)-1-hydroxy-6-methyl-5-methylideneheptan-2-yl]-6-(3-hydroxypropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-2-ol |
| SMILES | CC(C)C(=C)CC[C@@H](CO)[C@H]1[C@@H](C[C@@]2([C@@]1(CC=C3C2=CC[C@H]([C@]3(C)CCCO)C(=C)C)C)C)O |
| InChI | InChI=1S/C31H50O3/c1-20(2)22(5)10-11-23(19-33)28-27(34)18-31(8)26-13-12-24(21(3)4)29(6,15-9-17-32)25(26)14-16-30(28,31)7/h13-14,20,23-24,27-28,32-34H,3,5,9-12,15-19H2,1-2,4,6-8H3/t23-,24-,27+,28-,29-,30+,31-/m0/s1 |
| InChIKey | HHINYALZKAWAOA-RGBBNCLUSA-N |
| XLogP | 6.60 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | 851 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|