C31H50O2 — CID 51042625
(2R)-2-[(3R,3aR,6S,7S,9bR)-6-(3-hydroxypropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptan-1-ol (PubChem CID 51042625) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is (2R)-2-[(3R,3aR,6S,7S,9bR)-6-(3-hydroxypropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptan-1-ol.
| Compound Name | (2R)-2-[(3R,3aR,6S,7S,9bR)-6-(3-hydroxypropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptan-1-ol |
|---|---|
| PubChem CID | 51042625 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | (2R)-2-[(3R,3aR,6S,7S,9bR)-6-(3-hydroxypropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptan-1-ol |
| SMILES | C=C(CC[C@@H](CO)[C@H]1CC[C@@]2(C)C3=CC[C@@H](C(=C)C)[C@](C)(CCCO)C3=CC[C@]12C)C(C)C |
| InChI | InChI=1S/C31H50O2/c1-21(2)23(5)10-11-24(20-33)26-14-17-31(8)28-13-12-25(22(3)4)29(6,16-9-19-32)27(28)15-18-30(26,31)7/h13,15,21,24-26,32-33H,3,5,9-12,14,16-20H2,1-2,4,6-8H3/t24-,25-,26+,29-,30+,31-/m0/s1 |
| InChIKey | LDWVZRRXYBSROZ-CBKWYONESA-N |
| XLogP | 7.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|