C12H11FN2O2 — CID 51043578
2-[3-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]acetic acid (PubChem CID 51043578) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]acetic acid.
| Compound Name | 2-[3-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 51043578 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]acetic acid |
| SMILES | Cc1[nH]nc(-c2ccc(F)cc2)c1CC(=O)O |
| InChI | InChI=1S/C12H11FN2O2/c1-7-10(6-11(16)17)12(15-14-7)8-2-4-9(13)5-3-8/h2-5H,6H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | HNWNGXGPYXXTTO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |