C21H26N2O5 — CID 51044682
N-[(4-methoxyphenyl)methyl]-2-[4-oxo-6-(piperidin-1-ylmethyl)pyran-3-yl]oxyacetamide (PubChem CID 51044682) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-[4-oxo-6-(piperidin-1-ylmethyl)pyran-3-yl]oxyacetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-[4-oxo-6-(piperidin-1-ylmethyl)pyran-3-yl]oxyacetamide |
|---|---|
| PubChem CID | 51044682 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-[4-oxo-6-(piperidin-1-ylmethyl)pyran-3-yl]oxyacetamide |
| SMILES | COc1ccc(CNC(=O)COc2coc(CN3CCCCC3)cc2=O)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-26-17-7-5-16(6-8-17)12-22-21(25)15-28-20-14-27-18(11-19(20)24)13-23-9-3-2-4-10-23/h5-8,11,14H,2-4,9-10,12-13,15H2,1H3,(H,22,25) |
| InChIKey | YNLULYAYEHADFX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |