C22H25N5O3S — CID 51045330
4-amino-8,8-dimethyl-5-(4-nitrophenyl)-2-propylsulfanyl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one (PubChem CID 51045330) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-amino-8,8-dimethyl-5-(4-nitrophenyl)-2-propylsulfanyl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one.
| Compound Name | 4-amino-8,8-dimethyl-5-(4-nitrophenyl)-2-propylsulfanyl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 51045330 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 4-amino-8,8-dimethyl-5-(4-nitrophenyl)-2-propylsulfanyl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one |
| SMILES | CCCSc1nc(N)c2c(n1)NC1=C(C(=O)CC(C)(C)C1)C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H25N5O3S/c1-4-9-31-21-25-19(23)18-16(12-5-7-13(8-6-12)27(29)30)17-14(24-20(18)26-21)10-22(2,3)11-15(17)28/h5-8,16H,4,9-11H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | FKAAFVDHIIKHIU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|