About 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide
5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 51049268) has the molecular formula C4H5BrN4O
and a molecular weight of 205.01 g/mol. Its IUPAC name is 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide |
| PubChem CID | 51049268 |
| Molecular Formula | C4H5BrN4O |
| Molecular Weight | 205.01 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CNC(=O)c1n[nH]c(Br)n1 |
| InChI | InChI=1S/C4H5BrN4O/c1-6-3(10)2-7-4(5)9-8-2/h1H3,(H,6,10)(H,7,8,9) |
| InChIKey | HGVOVDZGTQSTFV-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.01 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide?
The IUPAC name of 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide (CID 51049268) is 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide is CNC(=O)c1n[nH]c(Br)n1.
What is the InChIKey of 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide?
The InChIKey is HGVOVDZGTQSTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrN4O/c1-6-3(10)2-7-4(5)9-8-2/h1H3,(H,6,10)(H,7,8,9).
What are the key properties of 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide?
5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide has a molecular weight of 205.01 g/mol, XLogP of -0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-methyl-1H-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 51049268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).