C25H30N4O3 — CID 51049416
4-[(1R,4R)-5-(1,3-benzodioxol-5-ylmethyl)-2,3,3,4-tetramethyl-6-oxo-1,3a,4,6a-tetrahydropyrrolo[3,4-c]pyrrol-1-yl]benzenecarboximidamide (PubChem CID 51049416) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[(1R,4R)-5-(1,3-benzodioxol-5-ylmethyl)-2,3,3,4-tetramethyl-6-oxo-1,3a,4,6a-tetrahydropyrrolo[3,4-c]pyrrol-1-yl]benzenecarboximidamide.
| Compound Name | 4-[(1R,4R)-5-(1,3-benzodioxol-5-ylmethyl)-2,3,3,4-tetramethyl-6-oxo-1,3a,4,6a-tetrahydropyrrolo[3,4-c]pyrrol-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 51049416 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-[(1R,4R)-5-(1,3-benzodioxol-5-ylmethyl)-2,3,3,4-tetramethyl-6-oxo-1,3a,4,6a-tetrahydropyrrolo[3,4-c]pyrrol-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc([C@H]2C3C(=O)N(Cc4ccc5c(c4)OCO5)[C@H](C)C3C(C)(C)N2C)cc1 |
| InChI | InChI=1S/C25H30N4O3/c1-14-21-20(24(30)29(14)12-15-5-10-18-19(11-15)32-13-31-18)22(28(4)25(21,2)3)16-6-8-17(9-7-16)23(26)27/h5-11,14,20-22H,12-13H2,1-4H3,(H3,26,27)/t14-,20?,21?,22+/m1/s1 |
| InChIKey | ZVHUDZOJVBUHDC-ZVIFSSHESA-N |
| XLogP | 3.13 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|