C16H26O5 — CID 51049447
(3S,4R,5R,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane-4,6-diol (PubChem CID 51049447) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3S,4R,5R,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane-4,6-diol.
| Compound Name | (3S,4R,5R,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane-4,6-diol |
|---|---|
| PubChem CID | 51049447 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (3S,4R,5R,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane-4,6-diol |
| SMILES | CO[C@@H]1[C@H](O)CC[C@]2(CO2)[C@@]1(O)[C@]1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C16H26O5/c1-10(2)5-6-12-14(3,21-12)16(18)13(19-4)11(17)7-8-15(16)9-20-15/h5,11-13,17-18H,6-9H2,1-4H3/t11-,12?,13-,14-,15+,16+/m1/s1 |
| InChIKey | KEGIIAOBTYLFPZ-LDZVSBDGSA-N |
| XLogP | 1.17 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|