About [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate
[4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 51049477) has the molecular formula C21H23N3O4S
and a molecular weight of 413.50 g/mol. Its IUPAC name is [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate |
| PubChem CID | 51049477 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Oc3ccc(CC(N)C(N)=O)cc3)cccc12 |
| InChI | InChI=1S/C21H23N3O4S/c1-24(2)19-7-3-6-17-16(19)5-4-8-20(17)29(26,27)28-15-11-9-14(10-12-15)13-18(22)21(23)25/h3-12,18H,13,22H2,1-2H3,(H2,23,25) |
| InChIKey | BOKYNYGGGWYXPH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate?
The IUPAC name of [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate (CID 51049477) is [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate.
What is the SMILES notation for [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate?
The canonical SMILES for [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate is CN(C)c1cccc2c(S(=O)(=O)Oc3ccc(CC(N)C(N)=O)cc3)cccc12.
What is the InChIKey of [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate?
The InChIKey is BOKYNYGGGWYXPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O4S/c1-24(2)19-7-3-6-17-16(19)5-4-8-20(17)29(26,27)28-15-11-9-14(10-12-15)13-18(22)21(23)25/h3-12,18H,13,22H2,1-2H3,(H2,23,25).
What are the key properties of [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate?
[4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate has a molecular weight of 413.50 g/mol, XLogP of 2.03, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-diamino-3-oxopropyl)phenyl] 5-(dimethylamino)naphthalene-1-sulfonate is sourced from PubChem (CID 51049477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).